C19H24N12O2 — CID 6263701
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-1-(benzotriazol-1-yl)propan-2-ylideneamino]-5-(diethylaminomethyl)triazole-4-carboxamide (PubChem CID 6263701) has the molecular formula C19H24N12O2 and a molecular weight of 452.48 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-1-(benzotriazol-1-yl)propan-2-ylideneamino]-5-(diethylaminomethyl)triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-1-(benzotriazol-1-yl)propan-2-ylideneamino]-5-(diethylaminomethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 6263701 |
| Molecular Formula | C19H24N12O2 |
| Molecular Weight | 452.48 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-1-(benzotriazol-1-yl)propan-2-ylideneamino]-5-(diethylaminomethyl)triazole-4-carboxamide |
| SMILES | CCN(CC)Cc1c(C(=O)N/N=C(/C)Cn2nnc3ccccc32)nnn1-c1nonc1N |
| InChI | InChI=1S/C19H24N12O2/c1-4-29(5-2)11-15-16(23-28-31(15)18-17(20)25-33-26-18)19(32)24-21-12(3)10-30-14-9-7-6-8-13(14)22-27-30/h6-9H,4-5,10-11H2,1-3H3,(H2,20,25)(H,24,32)/b21-12- |
| InChIKey | QLXRSUFBECUBJH-MTJSOVHGSA-N |
| XLogP | 0.62 |
| TPSA | 171.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.48 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|