C22H23N9O4 — CID 135651391
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-1-(4-hydroxy-3-methoxyphenyl)ethylideneamino]-5-[(N-methylanilino)methyl]triazole-4-carboxamide (PubChem CID 135651391) has the molecular formula C22H23N9O4 and a molecular weight of 477.49 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-1-(4-hydroxy-3-methoxyphenyl)ethylideneamino]-5-[(N-methylanilino)methyl]triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-1-(4-hydroxy-3-methoxyphenyl)ethylideneamino]-5-[(N-methylanilino)methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 135651391 |
| Molecular Formula | C22H23N9O4 |
| Molecular Weight | 477.49 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-1-(4-hydroxy-3-methoxyphenyl)ethylideneamino]-5-[(N-methylanilino)methyl]triazole-4-carboxamide |
| SMILES | COc1cc(/C(C)=N/NC(=O)c2nnn(-c3nonc3N)c2CN(C)c2ccccc2)ccc1O |
| InChI | InChI=1S/C22H23N9O4/c1-13(14-9-10-17(32)18(11-14)34-3)24-26-22(33)19-16(12-30(2)15-7-5-4-6-8-15)31(29-25-19)21-20(23)27-35-28-21/h4-11,32H,12H2,1-3H3,(H2,23,27)(H,26,33)/b24-13+ |
| InChIKey | HVAHFPMFGKWZKY-ZMOGYAJESA-N |
| XLogP | 1.74 |
| TPSA | 169.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.49 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|