C19H19N9O2S — CID 3832316
1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(N-methylanilino)methyl]-N-[(5-methylthiophen-2-yl)methylideneamino]triazole-4-carboxamide (PubChem CID 3832316) has the molecular formula C19H19N9O2S and a molecular weight of 437.49 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(N-methylanilino)methyl]-N-[(5-methylthiophen-2-yl)methylideneamino]triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(N-methylanilino)methyl]-N-[(5-methylthiophen-2-yl)methylideneamino]triazole-4-carboxamide |
|---|---|
| PubChem CID | 3832316 |
| Molecular Formula | C19H19N9O2S |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(N-methylanilino)methyl]-N-[(5-methylthiophen-2-yl)methylideneamino]triazole-4-carboxamide |
| SMILES | Cc1ccc(C=NNC(=O)c2nnn(-c3nonc3N)c2CN(C)c2ccccc2)s1 |
| InChI | InChI=1S/C19H19N9O2S/c1-12-8-9-14(31-12)10-21-23-19(29)16-15(11-27(2)13-6-4-3-5-7-13)28(26-22-16)18-17(20)24-30-25-18/h3-10H,11H2,1-2H3,(H2,20,24)(H,23,29) |
| InChIKey | XBQDVIQDNLZMQA-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 140.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|