C14H16N8O2S — CID 6147551
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(5-methylthiophen-2-yl)methylideneamino]-5-propan-2-yltriazole-4-carboxamide (PubChem CID 6147551) has the molecular formula C14H16N8O2S and a molecular weight of 360.40 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(5-methylthiophen-2-yl)methylideneamino]-5-propan-2-yltriazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(5-methylthiophen-2-yl)methylideneamino]-5-propan-2-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 6147551 |
| Molecular Formula | C14H16N8O2S |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(5-methylthiophen-2-yl)methylideneamino]-5-propan-2-yltriazole-4-carboxamide |
| SMILES | Cc1ccc(/C=N\NC(=O)c2nnn(-c3nonc3N)c2C(C)C)s1 |
| InChI | InChI=1S/C14H16N8O2S/c1-7(2)11-10(17-21-22(11)13-12(15)19-24-20-13)14(23)18-16-6-9-5-4-8(3)25-9/h4-7H,1-3H3,(H2,15,19)(H,18,23)/b16-6- |
| InChIKey | IVPHQVUHKLBEPC-SOFYXZRVSA-N |
| XLogP | 1.49 |
| TPSA | 137.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|