C20H25N9O3 — CID 136846221
1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[[cyclohexyl(methyl)amino]methyl]-N-[(Z)-(2-hydroxyphenyl)methylideneamino]triazole-4-carboxamide (PubChem CID 136846221) has the molecular formula C20H25N9O3 and a molecular weight of 439.48 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[[cyclohexyl(methyl)amino]methyl]-N-[(Z)-(2-hydroxyphenyl)methylideneamino]triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[[cyclohexyl(methyl)amino]methyl]-N-[(Z)-(2-hydroxyphenyl)methylideneamino]triazole-4-carboxamide |
|---|---|
| PubChem CID | 136846221 |
| Molecular Formula | C20H25N9O3 |
| Molecular Weight | 439.48 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[[cyclohexyl(methyl)amino]methyl]-N-[(Z)-(2-hydroxyphenyl)methylideneamino]triazole-4-carboxamide |
| SMILES | CN(Cc1c(C(=O)N/N=C\c2ccccc2O)nnn1-c1nonc1N)C1CCCCC1 |
| InChI | InChI=1S/C20H25N9O3/c1-28(14-8-3-2-4-9-14)12-15-17(23-27-29(15)19-18(21)25-32-26-19)20(31)24-22-11-13-7-5-6-10-16(13)30/h5-7,10-11,14,30H,2-4,8-9,12H2,1H3,(H2,21,25)(H,24,31)/b22-11- |
| InChIKey | ICVXHANKWSMDRE-JJFYIABZSA-N |
| XLogP | 1.47 |
| TPSA | 160.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.48 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|