C20H26N9O4+ — CID 135851673
[3-(4-amino-1,2,5-oxadiazol-3-yl)-5-[[(E)-(2,4-dihydroxyphenyl)methylideneamino]carbamoyl]triazol-4-yl]methyl-cyclohexyl-methylazanium (PubChem CID 135851673) has the molecular formula C20H26N9O4+ and a molecular weight of 456.49 g/mol. Its IUPAC name is [3-(4-amino-1,2,5-oxadiazol-3-yl)-5-[[(E)-(2,4-dihydroxyphenyl)methylideneamino]carbamoyl]triazol-4-yl]methyl-cyclohexyl-methylazanium.
| Compound Name | [3-(4-amino-1,2,5-oxadiazol-3-yl)-5-[[(E)-(2,4-dihydroxyphenyl)methylideneamino]carbamoyl]triazol-4-yl]methyl-cyclohexyl-methylazanium |
|---|---|
| PubChem CID | 135851673 |
| Molecular Formula | C20H26N9O4+ |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | [3-(4-amino-1,2,5-oxadiazol-3-yl)-5-[[(E)-(2,4-dihydroxyphenyl)methylideneamino]carbamoyl]triazol-4-yl]methyl-cyclohexyl-methylazanium |
| SMILES | C[NH+](Cc1c(C(=O)N/N=C/c2ccc(O)cc2O)nnn1-c1nonc1N)C1CCCCC1 |
| InChI | InChI=1S/C20H25N9O4/c1-28(13-5-3-2-4-6-13)11-15-17(23-27-29(15)19-18(21)25-33-26-19)20(32)24-22-10-12-7-8-14(30)9-16(12)31/h7-10,13,30-31H,2-6,11H2,1H3,(H2,21,25)(H,24,32)/p+1/b22-10+ |
| InChIKey | JFLJLTAKGOBOLC-LSHDLFTRSA-O |
| XLogP | -0.25 |
| TPSA | 182.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|