C19H23N9O2 — CID 6074335
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-benzylideneamino]-5-[(2-methylpiperidin-1-yl)methyl]triazole-4-carboxamide (PubChem CID 6074335) has the molecular formula C19H23N9O2 and a molecular weight of 409.45 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-benzylideneamino]-5-[(2-methylpiperidin-1-yl)methyl]triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-benzylideneamino]-5-[(2-methylpiperidin-1-yl)methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 6074335 |
| Molecular Formula | C19H23N9O2 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-benzylideneamino]-5-[(2-methylpiperidin-1-yl)methyl]triazole-4-carboxamide |
| SMILES | CC1CCCCN1Cc1c(C(=O)N/N=C\c2ccccc2)nnn1-c1nonc1N |
| InChI | InChI=1S/C19H23N9O2/c1-13-7-5-6-10-27(13)12-15-16(22-26-28(15)18-17(20)24-30-25-18)19(29)23-21-11-14-8-3-2-4-9-14/h2-4,8-9,11,13H,5-7,10,12H2,1H3,(H2,20,24)(H,23,29)/b21-11- |
| InChIKey | XVJMWKJQXRVDRD-NHDPSOOVSA-N |
| XLogP | 1.37 |
| TPSA | 140.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|