C18H24N10O2 — CID 92958140
1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[[(2S)-2-methylpiperidin-1-yl]methyl]-N-[(E)-(1-methylpyrrol-2-yl)methylideneamino]triazole-4-carboxamide (PubChem CID 92958140) has the molecular formula C18H24N10O2 and a molecular weight of 412.46 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[[(2S)-2-methylpiperidin-1-yl]methyl]-N-[(E)-(1-methylpyrrol-2-yl)methylideneamino]triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[[(2S)-2-methylpiperidin-1-yl]methyl]-N-[(E)-(1-methylpyrrol-2-yl)methylideneamino]triazole-4-carboxamide |
|---|---|
| PubChem CID | 92958140 |
| Molecular Formula | C18H24N10O2 |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[[(2S)-2-methylpiperidin-1-yl]methyl]-N-[(E)-(1-methylpyrrol-2-yl)methylideneamino]triazole-4-carboxamide |
| SMILES | C[C@H]1CCCCN1Cc1c(C(=O)N/N=C/c2cccn2C)nnn1-c1nonc1N |
| InChI | InChI=1S/C18H24N10O2/c1-12-6-3-4-9-27(12)11-14-15(21-25-28(14)17-16(19)23-30-24-17)18(29)22-20-10-13-7-5-8-26(13)2/h5,7-8,10,12H,3-4,6,9,11H2,1-2H3,(H2,19,23)(H,22,29)/b20-10+/t12-/m0/s1 |
| InChIKey | BFZKVXCWKYYMRY-QDBSGRMGSA-N |
| XLogP | 0.71 |
| TPSA | 145.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hzone_pyrrol(64)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|