C27H39N9O3 — CID 136803470
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-5-[[(2R)-2-methylpiperidin-1-yl]methyl]triazole-4-carboxamide (PubChem CID 136803470) has the molecular formula C27H39N9O3 and a molecular weight of 537.67 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-5-[[(2R)-2-methylpiperidin-1-yl]methyl]triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-5-[[(2R)-2-methylpiperidin-1-yl]methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 136803470 |
| Molecular Formula | C27H39N9O3 |
| Molecular Weight | 537.67 g/mol |
| Exact Mass | 537.32 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-5-[[(2R)-2-methylpiperidin-1-yl]methyl]triazole-4-carboxamide |
| SMILES | C[C@@H]1CCCCN1Cc1c(C(=O)N/N=C/c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)nnn1-c1nonc1N |
| InChI | InChI=1S/C27H39N9O3/c1-16-10-8-9-11-35(16)15-20-21(30-34-36(20)24-23(28)32-39-33-24)25(38)31-29-14-17-12-18(26(2,3)4)22(37)19(13-17)27(5,6)7/h12-14,16,37H,8-11,15H2,1-7H3,(H2,28,32)(H,31,38)/b29-14+/t16-/m1/s1 |
| InChIKey | GPNCZOYULPTXIL-ZJIVOUCISA-N |
| XLogP | 3.67 |
| TPSA | 160.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.67 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|