C17H21ClN10O4S — CID 45054126
1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(2-methylpiperidin-1-yl)methyl]-N-[(Z)-(5-nitrothiophen-2-yl)methylideneamino]triazole-4-carboxamide;hydrochloride (PubChem CID 45054126) has the molecular formula C17H21ClN10O4S and a molecular weight of 496.94 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(2-methylpiperidin-1-yl)methyl]-N-[(Z)-(5-nitrothiophen-2-yl)methylideneamino]triazole-4-carboxamide;hydrochloride.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(2-methylpiperidin-1-yl)methyl]-N-[(Z)-(5-nitrothiophen-2-yl)methylideneamino]triazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 45054126 |
| Molecular Formula | C17H21ClN10O4S |
| Molecular Weight | 496.94 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(2-methylpiperidin-1-yl)methyl]-N-[(Z)-(5-nitrothiophen-2-yl)methylideneamino]triazole-4-carboxamide;hydrochloride |
| SMILES | CC1CCCCN1Cc1c(C(=O)N/N=C\c2ccc([N+](=O)[O-])s2)nnn1-c1nonc1N.Cl |
| InChI | InChI=1S/C17H20N10O4S.ClH/c1-10-4-2-3-7-25(10)9-12-14(20-24-26(12)16-15(18)22-31-23-16)17(28)21-19-8-11-5-6-13(32-11)27(29)30;/h5-6,8,10H,2-4,7,9H2,1H3,(H2,18,22)(H,21,28);1H/b19-8-; |
| InChIKey | XISHRXINDQWODE-SRJUEMFDSA-N |
| XLogP | 1.76 |
| TPSA | 183.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.94 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|