C24H27N9O2 — CID 6249438
1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(2-methylpiperidin-1-yl)methyl]-N-[(Z)-1-naphthalen-2-ylethylideneamino]triazole-4-carboxamide (PubChem CID 6249438) has the molecular formula C24H27N9O2 and a molecular weight of 473.54 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(2-methylpiperidin-1-yl)methyl]-N-[(Z)-1-naphthalen-2-ylethylideneamino]triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(2-methylpiperidin-1-yl)methyl]-N-[(Z)-1-naphthalen-2-ylethylideneamino]triazole-4-carboxamide |
|---|---|
| PubChem CID | 6249438 |
| Molecular Formula | C24H27N9O2 |
| Molecular Weight | 473.54 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(2-methylpiperidin-1-yl)methyl]-N-[(Z)-1-naphthalen-2-ylethylideneamino]triazole-4-carboxamide |
| SMILES | C/C(=N/NC(=O)c1nnn(-c2nonc2N)c1CN1CCCCC1C)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H27N9O2/c1-15-7-5-6-12-32(15)14-20-21(27-31-33(20)23-22(25)29-35-30-23)24(34)28-26-16(2)18-11-10-17-8-3-4-9-19(17)13-18/h3-4,8-11,13,15H,5-7,12,14H2,1-2H3,(H2,25,29)(H,28,34)/b26-16- |
| InChIKey | LMMDPQATMDPKOQ-QQXSKIMKSA-N |
| XLogP | 2.91 |
| TPSA | 140.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.54 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|