C20H18N10O5 — CID 136846336
1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(2-carbamoylanilino)methyl]-N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]triazole-4-carboxamide (PubChem CID 136846336) has the molecular formula C20H18N10O5 and a molecular weight of 478.43 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(2-carbamoylanilino)methyl]-N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(2-carbamoylanilino)methyl]-N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]triazole-4-carboxamide |
|---|---|
| PubChem CID | 136846336 |
| Molecular Formula | C20H18N10O5 |
| Molecular Weight | 478.43 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(2-carbamoylanilino)methyl]-N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]triazole-4-carboxamide |
| SMILES | NC(=O)c1ccccc1NCc1c(C(=O)N/N=C\c2ccc(O)cc2O)nnn1-c1nonc1N |
| InChI | InChI=1S/C20H18N10O5/c21-17-19(28-35-27-17)30-14(9-23-13-4-2-1-3-12(13)18(22)33)16(25-29-30)20(34)26-24-8-10-5-6-11(31)7-15(10)32/h1-8,23,31-32H,9H2,(H2,21,27)(H2,22,33)(H,26,34)/b24-8- |
| InChIKey | IEQIKXNHCXCGOR-GYRAYZOKSA-N |
| XLogP | 0.12 |
| TPSA | 232.69 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.43 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|