C19H16N8O4S — CID 136815839
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]-5-(phenylsulfanylmethyl)triazole-4-carboxamide (PubChem CID 136815839) has the molecular formula C19H16N8O4S and a molecular weight of 452.46 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]-5-(phenylsulfanylmethyl)triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]-5-(phenylsulfanylmethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 136815839 |
| Molecular Formula | C19H16N8O4S |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]-5-(phenylsulfanylmethyl)triazole-4-carboxamide |
| SMILES | Nc1nonc1-n1nnc(C(=O)N/N=C\c2ccc(O)cc2O)c1CSc1ccccc1 |
| InChI | InChI=1S/C19H16N8O4S/c20-17-18(25-31-24-17)27-14(10-32-13-4-2-1-3-5-13)16(22-26-27)19(30)23-21-9-11-6-7-12(28)8-15(11)29/h1-9,28-29H,10H2,(H2,20,24)(H,23,30)/b21-9- |
| InChIKey | SKPPZILRQXXGLL-NKVSQWTQSA-N |
| XLogP | 1.70 |
| TPSA | 177.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|