C17H14N8O2S2 — CID 6889641
1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(phenylsulfanylmethyl)-N-[(E)-thiophen-3-ylmethylideneamino]triazole-4-carboxamide (PubChem CID 6889641) has the molecular formula C17H14N8O2S2 and a molecular weight of 426.49 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(phenylsulfanylmethyl)-N-[(E)-thiophen-3-ylmethylideneamino]triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(phenylsulfanylmethyl)-N-[(E)-thiophen-3-ylmethylideneamino]triazole-4-carboxamide |
|---|---|
| PubChem CID | 6889641 |
| Molecular Formula | C17H14N8O2S2 |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(phenylsulfanylmethyl)-N-[(E)-thiophen-3-ylmethylideneamino]triazole-4-carboxamide |
| SMILES | Nc1nonc1-n1nnc(C(=O)N/N=C/c2ccsc2)c1CSc1ccccc1 |
| InChI | InChI=1S/C17H14N8O2S2/c18-15-16(23-27-22-15)25-13(10-29-12-4-2-1-3-5-12)14(20-24-25)17(26)21-19-8-11-6-7-28-9-11/h1-9H,10H2,(H2,18,22)(H,21,26)/b19-8+ |
| InChIKey | TYFATLKTBXADLJ-UFWORHAWSA-N |
| XLogP | 2.35 |
| TPSA | 137.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|