C23H24N8O2S — CID 3346818
1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(4-methylphenyl)sulfanylmethyl]-N-[(2,4,6-trimethylphenyl)methylideneamino]triazole-4-carboxamide (PubChem CID 3346818) has the molecular formula C23H24N8O2S and a molecular weight of 476.57 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(4-methylphenyl)sulfanylmethyl]-N-[(2,4,6-trimethylphenyl)methylideneamino]triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(4-methylphenyl)sulfanylmethyl]-N-[(2,4,6-trimethylphenyl)methylideneamino]triazole-4-carboxamide |
|---|---|
| PubChem CID | 3346818 |
| Molecular Formula | C23H24N8O2S |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(4-methylphenyl)sulfanylmethyl]-N-[(2,4,6-trimethylphenyl)methylideneamino]triazole-4-carboxamide |
| SMILES | Cc1ccc(SCc2c(C(=O)NN=Cc3c(C)cc(C)cc3C)nnn2-c2nonc2N)cc1 |
| InChI | InChI=1S/C23H24N8O2S/c1-13-5-7-17(8-6-13)34-12-19-20(26-30-31(19)22-21(24)28-33-29-22)23(32)27-25-11-18-15(3)9-14(2)10-16(18)4/h5-11H,12H2,1-4H3,(H2,24,28)(H,27,32) |
| InChIKey | XGIQBJISYXOANM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 137.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|