C20H16Cl2N8O4 — CID 136752811
1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(3,4-dichlorophenyl)-N-[(Z)-1-(4-hydroxy-3-methoxyphenyl)ethylideneamino]triazole-4-carboxamide (PubChem CID 136752811) has the molecular formula C20H16Cl2N8O4 and a molecular weight of 503.31 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(3,4-dichlorophenyl)-N-[(Z)-1-(4-hydroxy-3-methoxyphenyl)ethylideneamino]triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(3,4-dichlorophenyl)-N-[(Z)-1-(4-hydroxy-3-methoxyphenyl)ethylideneamino]triazole-4-carboxamide |
|---|---|
| PubChem CID | 136752811 |
| Molecular Formula | C20H16Cl2N8O4 |
| Molecular Weight | 503.31 g/mol |
| Exact Mass | 502.07 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(3,4-dichlorophenyl)-N-[(Z)-1-(4-hydroxy-3-methoxyphenyl)ethylideneamino]triazole-4-carboxamide |
| SMILES | COc1cc(/C(C)=N\NC(=O)c2nnn(-c3nonc3N)c2-c2ccc(Cl)c(Cl)c2)ccc1O |
| InChI | InChI=1S/C20H16Cl2N8O4/c1-9(10-4-6-14(31)15(8-10)33-2)24-26-20(32)16-17(11-3-5-12(21)13(22)7-11)30(29-25-16)19-18(23)27-34-28-19/h3-8,31H,1-2H3,(H2,23,27)(H,26,32)/b24-9- |
| InChIKey | NOTCYAVGTSGKNH-OPVMPGTRSA-N |
| XLogP | 3.07 |
| TPSA | 166.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|