C21H19ClN8O3 — CID 3771279
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[1-(3-chlorophenyl)ethylideneamino]-5-(3-ethoxyphenyl)triazole-4-carboxamide (PubChem CID 3771279) has the molecular formula C21H19ClN8O3 and a molecular weight of 466.89 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[1-(3-chlorophenyl)ethylideneamino]-5-(3-ethoxyphenyl)triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[1-(3-chlorophenyl)ethylideneamino]-5-(3-ethoxyphenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 3771279 |
| Molecular Formula | C21H19ClN8O3 |
| Molecular Weight | 466.89 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[1-(3-chlorophenyl)ethylideneamino]-5-(3-ethoxyphenyl)triazole-4-carboxamide |
| SMILES | CCOc1cccc(-c2c(C(=O)NN=C(C)c3cccc(Cl)c3)nnn2-c2nonc2N)c1 |
| InChI | InChI=1S/C21H19ClN8O3/c1-3-32-16-9-5-7-14(11-16)18-17(25-29-30(18)20-19(23)27-33-28-20)21(31)26-24-12(2)13-6-4-8-15(22)10-13/h4-11H,3H2,1-2H3,(H2,23,27)(H,26,31) |
| InChIKey | VJYDVYHHGWTDPP-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 146.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.89 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|