C14H17N9O3 — CID 4859911
1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(dimethylamino)methyl]-N-[1-(furan-2-yl)ethylideneamino]triazole-4-carboxamide (PubChem CID 4859911) has the molecular formula C14H17N9O3 and a molecular weight of 359.35 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(dimethylamino)methyl]-N-[1-(furan-2-yl)ethylideneamino]triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(dimethylamino)methyl]-N-[1-(furan-2-yl)ethylideneamino]triazole-4-carboxamide |
|---|---|
| PubChem CID | 4859911 |
| Molecular Formula | C14H17N9O3 |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(dimethylamino)methyl]-N-[1-(furan-2-yl)ethylideneamino]triazole-4-carboxamide |
| SMILES | CC(=NNC(=O)c1nnn(-c2nonc2N)c1CN(C)C)c1ccco1 |
| InChI | InChI=1S/C14H17N9O3/c1-8(10-5-4-6-25-10)16-18-14(24)11-9(7-22(2)3)23(21-17-11)13-12(15)19-26-20-13/h4-6H,7H2,1-3H3,(H2,15,19)(H,18,24) |
| InChIKey | QWTATSPEOSOHAJ-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 153.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|