C16H19N9O3S — CID 6322913
1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(morpholin-4-ylmethyl)-N-[(Z)-1-thiophen-2-ylethylideneamino]triazole-4-carboxamide (PubChem CID 6322913) has the molecular formula C16H19N9O3S and a molecular weight of 417.46 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(morpholin-4-ylmethyl)-N-[(Z)-1-thiophen-2-ylethylideneamino]triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(morpholin-4-ylmethyl)-N-[(Z)-1-thiophen-2-ylethylideneamino]triazole-4-carboxamide |
|---|---|
| PubChem CID | 6322913 |
| Molecular Formula | C16H19N9O3S |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(morpholin-4-ylmethyl)-N-[(Z)-1-thiophen-2-ylethylideneamino]triazole-4-carboxamide |
| SMILES | C/C(=N/NC(=O)c1nnn(-c2nonc2N)c1CN1CCOCC1)c1cccs1 |
| InChI | InChI=1S/C16H19N9O3S/c1-10(12-3-2-8-29-12)18-20-16(26)13-11(9-24-4-6-27-7-5-24)25(23-19-13)15-14(17)21-28-22-15/h2-3,8H,4-7,9H2,1H3,(H2,17,21)(H,20,26)/b18-10- |
| InChIKey | VWBYAUFVAJIGEJ-ZDLGFXPLSA-N |
| XLogP | 0.28 |
| TPSA | 149.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|