C18H24ClN11O5 — CID 171669365
1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(4-ethylpiperazin-1-yl)methyl]-N-[(E)-1-(5-nitrofuran-2-yl)ethylideneamino]triazole-4-carboxamide;hydrochloride (PubChem CID 171669365) has the molecular formula C18H24ClN11O5 and a molecular weight of 509.92 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(4-ethylpiperazin-1-yl)methyl]-N-[(E)-1-(5-nitrofuran-2-yl)ethylideneamino]triazole-4-carboxamide;hydrochloride.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(4-ethylpiperazin-1-yl)methyl]-N-[(E)-1-(5-nitrofuran-2-yl)ethylideneamino]triazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 171669365 |
| Molecular Formula | C18H24ClN11O5 |
| Molecular Weight | 509.92 g/mol |
| Exact Mass | 509.17 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(4-ethylpiperazin-1-yl)methyl]-N-[(E)-1-(5-nitrofuran-2-yl)ethylideneamino]triazole-4-carboxamide;hydrochloride |
| SMILES | CCN1CCN(Cc2c(C(=O)N/N=C(\C)c3ccc([N+](=O)[O-])o3)nnn2-c2nonc2N)CC1.Cl |
| InChI | InChI=1S/C18H23N11O5.ClH/c1-3-26-6-8-27(9-7-26)10-12-15(21-25-28(12)17-16(19)23-34-24-17)18(30)22-20-11(2)13-4-5-14(33-13)29(31)32;/h4-5H,3,6-10H2,1-2H3,(H2,19,23)(H,22,30);1H/b20-11+; |
| InChIKey | AKFRCEPZYLJRAL-DOELHFPHSA-N |
| XLogP | 0.45 |
| TPSA | 199.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.92 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|