C22H20N10O4 — CID 6078995
1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(2,3-dihydroindol-1-ylmethyl)-N-[(Z)-1-(3-nitrophenyl)ethylideneamino]triazole-4-carboxamide (PubChem CID 6078995) has the molecular formula C22H20N10O4 and a molecular weight of 488.47 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(2,3-dihydroindol-1-ylmethyl)-N-[(Z)-1-(3-nitrophenyl)ethylideneamino]triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(2,3-dihydroindol-1-ylmethyl)-N-[(Z)-1-(3-nitrophenyl)ethylideneamino]triazole-4-carboxamide |
|---|---|
| PubChem CID | 6078995 |
| Molecular Formula | C22H20N10O4 |
| Molecular Weight | 488.47 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(2,3-dihydroindol-1-ylmethyl)-N-[(Z)-1-(3-nitrophenyl)ethylideneamino]triazole-4-carboxamide |
| SMILES | C/C(=N/NC(=O)c1nnn(-c2nonc2N)c1CN1CCc2ccccc21)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H20N10O4/c1-13(15-6-4-7-16(11-15)32(34)35)24-26-22(33)19-18(31(29-25-19)21-20(23)27-36-28-21)12-30-10-9-14-5-2-3-8-17(14)30/h2-8,11H,9-10,12H2,1H3,(H2,23,27)(H,26,33)/b24-13- |
| InChIKey | NSWHVHKBHJBGMM-CFRMEGHHSA-N |
| XLogP | 1.86 |
| TPSA | 183.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.47 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|