C30H26ClN9O5 — CID 4693808
[4-[N-[[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(2,3-dihydroindol-1-ylmethyl)triazole-4-carbonyl]amino]-C-methylcarbonimidoyl]-2-methoxyphenyl] 4-chlorobenzoate (PubChem CID 4693808) has the molecular formula C30H26ClN9O5 and a molecular weight of 628.05 g/mol. Its IUPAC name is [4-[N-[[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(2,3-dihydroindol-1-ylmethyl)triazole-4-carbonyl]amino]-C-methylcarbonimidoyl]-2-methoxyphenyl] 4-chlorobenzoate.
| Compound Name | [4-[N-[[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(2,3-dihydroindol-1-ylmethyl)triazole-4-carbonyl]amino]-C-methylcarbonimidoyl]-2-methoxyphenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 4693808 |
| Molecular Formula | C30H26ClN9O5 |
| Molecular Weight | 628.05 g/mol |
| Exact Mass | 627.17 |
| IUPAC Name | [4-[N-[[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(2,3-dihydroindol-1-ylmethyl)triazole-4-carbonyl]amino]-C-methylcarbonimidoyl]-2-methoxyphenyl] 4-chlorobenzoate |
| SMILES | COc1cc(C(C)=NNC(=O)c2nnn(-c3nonc3N)c2CN2CCc3ccccc32)ccc1OC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H26ClN9O5/c1-17(20-9-12-24(25(15-20)43-2)44-30(42)19-7-10-21(31)11-8-19)33-35-29(41)26-23(40(38-34-26)28-27(32)36-45-37-28)16-39-14-13-18-5-3-4-6-22(18)39/h3-12,15H,13-14,16H2,1-2H3,(H2,32,36)(H,35,41) |
| InChIKey | WGIPUSNVZBWZAW-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 175.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.05 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|