C25H29N9O3 — CID 44726783
3-(4-amino-1,2,5-oxadiazol-3-yl)-5-(diethylaminomethyl)-N-[(E)-[4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]triazole-4-carboxamide (PubChem CID 44726783) has the molecular formula C25H29N9O3 and a molecular weight of 503.57 g/mol. Its IUPAC name is 3-(4-amino-1,2,5-oxadiazol-3-yl)-5-(diethylaminomethyl)-N-[(E)-[4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]triazole-4-carboxamide.
| Compound Name | 3-(4-amino-1,2,5-oxadiazol-3-yl)-5-(diethylaminomethyl)-N-[(E)-[4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]triazole-4-carboxamide |
|---|---|
| PubChem CID | 44726783 |
| Molecular Formula | C25H29N9O3 |
| Molecular Weight | 503.57 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | 3-(4-amino-1,2,5-oxadiazol-3-yl)-5-(diethylaminomethyl)-N-[(E)-[4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]triazole-4-carboxamide |
| SMILES | CCN(CC)Cc1nnn(-c2nonc2N)c1C(=O)N/N=C/c1ccc(OCc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C25H29N9O3/c1-4-33(5-2)15-21-22(34(32-28-21)24-23(26)30-37-31-24)25(35)29-27-14-18-10-12-20(13-11-18)36-16-19-8-6-17(3)7-9-19/h6-14H,4-5,15-16H2,1-3H3,(H2,26,30)(H,29,35)/b27-14+ |
| InChIKey | IHALDCDHFTVLSL-MZJWZYIUSA-N |
| XLogP | 2.73 |
| TPSA | 149.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.57 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|