C18H24ClN9O2 — CID 45053862
3-(4-amino-1,2,5-oxadiazol-3-yl)-5-(diethylaminomethyl)-N-[(E)-(4-methylphenyl)methylideneamino]triazole-4-carboxamide;hydrochloride (PubChem CID 45053862) has the molecular formula C18H24ClN9O2 and a molecular weight of 433.90 g/mol. Its IUPAC name is 3-(4-amino-1,2,5-oxadiazol-3-yl)-5-(diethylaminomethyl)-N-[(E)-(4-methylphenyl)methylideneamino]triazole-4-carboxamide;hydrochloride.
| Compound Name | 3-(4-amino-1,2,5-oxadiazol-3-yl)-5-(diethylaminomethyl)-N-[(E)-(4-methylphenyl)methylideneamino]triazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 45053862 |
| Molecular Formula | C18H24ClN9O2 |
| Molecular Weight | 433.90 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 3-(4-amino-1,2,5-oxadiazol-3-yl)-5-(diethylaminomethyl)-N-[(E)-(4-methylphenyl)methylideneamino]triazole-4-carboxamide;hydrochloride |
| SMILES | CCN(CC)Cc1nnn(-c2nonc2N)c1C(=O)N/N=C/c1ccc(C)cc1.Cl |
| InChI | InChI=1S/C18H23N9O2.ClH/c1-4-26(5-2)11-14-15(27(25-21-14)17-16(19)23-29-24-17)18(28)22-20-10-13-8-6-12(3)7-9-13;/h6-10H,4-5,11H2,1-3H3,(H2,19,23)(H,22,28);1H/b20-10+; |
| InChIKey | JSZPSIUWJXLIBJ-XZISABOOSA-N |
| XLogP | 1.57 |
| TPSA | 140.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.90 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|