C13H10Cl2N8O2 — CID 4695559
3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(3,4-dichlorophenyl)methylideneamino]-5-methyltriazole-4-carboxamide (PubChem CID 4695559) has the molecular formula C13H10Cl2N8O2 and a molecular weight of 381.18 g/mol. Its IUPAC name is 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(3,4-dichlorophenyl)methylideneamino]-5-methyltriazole-4-carboxamide.
| Compound Name | 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(3,4-dichlorophenyl)methylideneamino]-5-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 4695559 |
| Molecular Formula | C13H10Cl2N8O2 |
| Molecular Weight | 381.18 g/mol |
| Exact Mass | 380.03 |
| IUPAC Name | 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(3,4-dichlorophenyl)methylideneamino]-5-methyltriazole-4-carboxamide |
| SMILES | Cc1nnn(-c2nonc2N)c1C(=O)NN=Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H10Cl2N8O2/c1-6-10(23(22-18-6)12-11(16)20-25-21-12)13(24)19-17-5-7-2-3-8(14)9(15)4-7/h2-5H,1H3,(H2,16,20)(H,19,24) |
| InChIKey | RKPDOYDDKNKTOZ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 137.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.18 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|