C25H28N8O5 — CID 45053853
[4-[(E)-[[3-(4-amino-1,2,5-oxadiazol-3-yl)-5-methyltriazole-4-carbonyl]hydrazinylidene]methyl]-2-methoxyphenyl] adamantane-2-carboxylate (PubChem CID 45053853) has the molecular formula C25H28N8O5 and a molecular weight of 520.55 g/mol. Its IUPAC name is [4-[(E)-[[3-(4-amino-1,2,5-oxadiazol-3-yl)-5-methyltriazole-4-carbonyl]hydrazinylidene]methyl]-2-methoxyphenyl] adamantane-2-carboxylate.
| Compound Name | [4-[(E)-[[3-(4-amino-1,2,5-oxadiazol-3-yl)-5-methyltriazole-4-carbonyl]hydrazinylidene]methyl]-2-methoxyphenyl] adamantane-2-carboxylate |
|---|---|
| PubChem CID | 45053853 |
| Molecular Formula | C25H28N8O5 |
| Molecular Weight | 520.55 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | [4-[(E)-[[3-(4-amino-1,2,5-oxadiazol-3-yl)-5-methyltriazole-4-carbonyl]hydrazinylidene]methyl]-2-methoxyphenyl] adamantane-2-carboxylate |
| SMILES | COc1cc(/C=N/NC(=O)c2c(C)nnn2-c2nonc2N)ccc1OC(=O)C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C25H28N8O5/c1-12-21(33(32-28-12)23-22(26)30-38-31-23)24(34)29-27-11-13-3-4-18(19(10-13)36-2)37-25(35)20-16-6-14-5-15(8-16)9-17(20)7-14/h3-4,10-11,14-17,20H,5-9H2,1-2H3,(H2,26,30)(H,29,34)/b27-11+ |
| InChIKey | BNZIOWQROQPLHF-LUOAPIJWSA-N |
| XLogP | 2.29 |
| TPSA | 172.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.55 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|