C21H19ClN8O4 — CID 3860363
3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-5-methyltriazole-4-carboxamide (PubChem CID 3860363) has the molecular formula C21H19ClN8O4 and a molecular weight of 482.89 g/mol. Its IUPAC name is 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-5-methyltriazole-4-carboxamide.
| Compound Name | 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-5-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 3860363 |
| Molecular Formula | C21H19ClN8O4 |
| Molecular Weight | 482.89 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-5-methyltriazole-4-carboxamide |
| SMILES | COc1cc(C=NNC(=O)c2c(C)nnn2-c2nonc2N)ccc1OCc1ccccc1Cl |
| InChI | InChI=1S/C21H19ClN8O4/c1-12-18(30(29-25-12)20-19(23)27-34-28-20)21(31)26-24-10-13-7-8-16(17(9-13)32-2)33-11-14-5-3-4-6-15(14)22/h3-10H,11H2,1-2H3,(H2,23,27)(H,26,31) |
| InChIKey | ZWOJLLGOVJNZLL-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 155.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.89 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|