C25H19ClN8O3 — CID 4176425
3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[[4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-5-phenyltriazole-4-carboxamide (PubChem CID 4176425) has the molecular formula C25H19ClN8O3 and a molecular weight of 514.93 g/mol. Its IUPAC name is 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[[4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-5-phenyltriazole-4-carboxamide.
| Compound Name | 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[[4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-5-phenyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 4176425 |
| Molecular Formula | C25H19ClN8O3 |
| Molecular Weight | 514.93 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[[4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-5-phenyltriazole-4-carboxamide |
| SMILES | Nc1nonc1-n1nnc(-c2ccccc2)c1C(=O)NN=Cc1ccc(OCc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C25H19ClN8O3/c26-20-9-5-4-8-18(20)15-36-19-12-10-16(11-13-19)14-28-30-25(35)22-21(17-6-2-1-3-7-17)29-33-34(22)24-23(27)31-37-32-24/h1-14H,15H2,(H2,27,31)(H,30,35) |
| InChIKey | BDNMLUQAOCXYEP-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 146.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.93 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|