C27H23BrN8O4 — CID 4623303
3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[[3-bromo-5-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methylideneamino]-5-phenyltriazole-4-carboxamide (PubChem CID 4623303) has the molecular formula C27H23BrN8O4 and a molecular weight of 603.44 g/mol. Its IUPAC name is 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[[3-bromo-5-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methylideneamino]-5-phenyltriazole-4-carboxamide.
| Compound Name | 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[[3-bromo-5-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methylideneamino]-5-phenyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 4623303 |
| Molecular Formula | C27H23BrN8O4 |
| Molecular Weight | 603.44 g/mol |
| Exact Mass | 602.10 |
| IUPAC Name | 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[[3-bromo-5-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methylideneamino]-5-phenyltriazole-4-carboxamide |
| SMILES | COc1cc(C=NNC(=O)c2c(-c3ccccc3)nnn2-c2nonc2N)cc(Br)c1OCc1ccccc1C |
| InChI | InChI=1S/C27H23BrN8O4/c1-16-8-6-7-11-19(16)15-39-24-20(28)12-17(13-21(24)38-2)14-30-32-27(37)23-22(18-9-4-3-5-10-18)31-35-36(23)26-25(29)33-40-34-26/h3-14H,15H2,1-2H3,(H2,29,33)(H,32,37) |
| InChIKey | TXQOQZSKRUOQGX-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 155.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.44 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|