C18H12Cl2N8O2 — CID 44727071
3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(2,4-dichlorophenyl)methylideneamino]-5-phenyltriazole-4-carboxamide (PubChem CID 44727071) has the molecular formula C18H12Cl2N8O2 and a molecular weight of 443.25 g/mol. Its IUPAC name is 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(2,4-dichlorophenyl)methylideneamino]-5-phenyltriazole-4-carboxamide.
| Compound Name | 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(2,4-dichlorophenyl)methylideneamino]-5-phenyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 44727071 |
| Molecular Formula | C18H12Cl2N8O2 |
| Molecular Weight | 443.25 g/mol |
| Exact Mass | 442.05 |
| IUPAC Name | 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(2,4-dichlorophenyl)methylideneamino]-5-phenyltriazole-4-carboxamide |
| SMILES | Nc1nonc1-n1nnc(-c2ccccc2)c1C(=O)N/N=C/c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H12Cl2N8O2/c19-12-7-6-11(13(20)8-12)9-22-24-18(29)15-14(10-4-2-1-3-5-10)23-27-28(15)17-16(21)25-30-26-17/h1-9H,(H2,21,25)(H,24,29)/b22-9+ |
| InChIKey | WTTFRQXMNBBPKI-LSFURLLWSA-N |
| XLogP | 2.97 |
| TPSA | 137.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.25 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|