C16H16N8O2 — CID 3766536
3-(4-amino-1,2,5-oxadiazol-3-yl)-N-(cyclopentylideneamino)-5-phenyltriazole-4-carboxamide (PubChem CID 3766536) has the molecular formula C16H16N8O2 and a molecular weight of 352.36 g/mol. Its IUPAC name is 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-(cyclopentylideneamino)-5-phenyltriazole-4-carboxamide.
| Compound Name | 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-(cyclopentylideneamino)-5-phenyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 3766536 |
| Molecular Formula | C16H16N8O2 |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-(cyclopentylideneamino)-5-phenyltriazole-4-carboxamide |
| SMILES | Nc1nonc1-n1nnc(-c2ccccc2)c1C(=O)NN=C1CCCC1 |
| InChI | InChI=1S/C16H16N8O2/c17-14-15(22-26-21-14)24-13(16(25)20-18-11-8-4-5-9-11)12(19-23-24)10-6-2-1-3-7-10/h1-3,6-7H,4-5,8-9H2,(H2,17,21)(H,20,25) |
| InChIKey | CMPBNOOOBLOPBJ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 137.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|