C26H21FN8O3 — CID 3855470
3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[1-[4-[(4-fluorophenyl)methoxy]phenyl]ethylideneamino]-5-phenyltriazole-4-carboxamide (PubChem CID 3855470) has the molecular formula C26H21FN8O3 and a molecular weight of 512.51 g/mol. Its IUPAC name is 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[1-[4-[(4-fluorophenyl)methoxy]phenyl]ethylideneamino]-5-phenyltriazole-4-carboxamide.
| Compound Name | 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[1-[4-[(4-fluorophenyl)methoxy]phenyl]ethylideneamino]-5-phenyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 3855470 |
| Molecular Formula | C26H21FN8O3 |
| Molecular Weight | 512.51 g/mol |
| Exact Mass | 512.17 |
| IUPAC Name | 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[1-[4-[(4-fluorophenyl)methoxy]phenyl]ethylideneamino]-5-phenyltriazole-4-carboxamide |
| SMILES | CC(=NNC(=O)c1c(-c2ccccc2)nnn1-c1nonc1N)c1ccc(OCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C26H21FN8O3/c1-16(18-9-13-21(14-10-18)37-15-17-7-11-20(27)12-8-17)29-31-26(36)23-22(19-5-3-2-4-6-19)30-34-35(23)25-24(28)32-38-33-25/h2-14H,15H2,1H3,(H2,28,32)(H,31,36) |
| InChIKey | RMKXWRDMAVESQM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 146.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.51 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|