C16H12N8O3S — CID 126478262
3-(4-amino-1,2,5-oxadiazol-3-yl)-5-phenyl-N'-(thiophene-2-carbonyl)triazole-4-carbohydrazide (PubChem CID 126478262) has the molecular formula C16H12N8O3S and a molecular weight of 396.39 g/mol. Its IUPAC name is 3-(4-amino-1,2,5-oxadiazol-3-yl)-5-phenyl-N'-(thiophene-2-carbonyl)triazole-4-carbohydrazide.
| Compound Name | 3-(4-amino-1,2,5-oxadiazol-3-yl)-5-phenyl-N'-(thiophene-2-carbonyl)triazole-4-carbohydrazide |
|---|---|
| PubChem CID | 126478262 |
| Molecular Formula | C16H12N8O3S |
| Molecular Weight | 396.39 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 3-(4-amino-1,2,5-oxadiazol-3-yl)-5-phenyl-N'-(thiophene-2-carbonyl)triazole-4-carbohydrazide |
| SMILES | Nc1nonc1-n1nnc(-c2ccccc2)c1C(=O)NNC(=O)c1cccs1 |
| InChI | InChI=1S/C16H12N8O3S/c17-13-14(22-27-21-13)24-12(11(18-23-24)9-5-2-1-3-6-9)16(26)20-19-15(25)10-7-4-8-28-10/h1-8H,(H2,17,21)(H,19,25)(H,20,26) |
| InChIKey | AODODMGQQUMQSJ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 153.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.39 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|