C25H18FN9O5 — CID 44727044
3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-[2-[(3-fluorophenyl)methoxy]-5-nitrophenyl]methylideneamino]-5-phenyltriazole-4-carboxamide (PubChem CID 44727044) has the molecular formula C25H18FN9O5 and a molecular weight of 543.48 g/mol. Its IUPAC name is 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-[2-[(3-fluorophenyl)methoxy]-5-nitrophenyl]methylideneamino]-5-phenyltriazole-4-carboxamide.
| Compound Name | 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-[2-[(3-fluorophenyl)methoxy]-5-nitrophenyl]methylideneamino]-5-phenyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 44727044 |
| Molecular Formula | C25H18FN9O5 |
| Molecular Weight | 543.48 g/mol |
| Exact Mass | 543.14 |
| IUPAC Name | 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-[2-[(3-fluorophenyl)methoxy]-5-nitrophenyl]methylideneamino]-5-phenyltriazole-4-carboxamide |
| SMILES | Nc1nonc1-n1nnc(-c2ccccc2)c1C(=O)N/N=C/c1cc([N+](=O)[O-])ccc1OCc1cccc(F)c1 |
| InChI | InChI=1S/C25H18FN9O5/c26-18-8-4-5-15(11-18)14-39-20-10-9-19(35(37)38)12-17(20)13-28-30-25(36)22-21(16-6-2-1-3-7-16)29-33-34(22)24-23(27)31-40-32-24/h1-13H,14H2,(H2,27,31)(H,30,36)/b28-13+ |
| InChIKey | BFYHLEDNMRSPRA-XODNFHPESA-N |
| XLogP | 3.29 |
| TPSA | 189.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|