C28H23N9O7 — CID 44727033
[4-[(E)-[[3-(4-amino-1,2,5-oxadiazol-3-yl)-5-phenyltriazole-4-carbonyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 3-methyl-4-nitrobenzoate (PubChem CID 44727033) has the molecular formula C28H23N9O7 and a molecular weight of 597.55 g/mol. Its IUPAC name is [4-[(E)-[[3-(4-amino-1,2,5-oxadiazol-3-yl)-5-phenyltriazole-4-carbonyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 3-methyl-4-nitrobenzoate.
| Compound Name | [4-[(E)-[[3-(4-amino-1,2,5-oxadiazol-3-yl)-5-phenyltriazole-4-carbonyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 3-methyl-4-nitrobenzoate |
|---|---|
| PubChem CID | 44727033 |
| Molecular Formula | C28H23N9O7 |
| Molecular Weight | 597.55 g/mol |
| Exact Mass | 597.17 |
| IUPAC Name | [4-[(E)-[[3-(4-amino-1,2,5-oxadiazol-3-yl)-5-phenyltriazole-4-carbonyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 3-methyl-4-nitrobenzoate |
| SMILES | CCOc1cc(/C=N/NC(=O)c2c(-c3ccccc3)nnn2-c2nonc2N)ccc1OC(=O)c1ccc([N+](=O)[O-])c(C)c1 |
| InChI | InChI=1S/C28H23N9O7/c1-3-42-22-14-17(9-12-21(22)43-28(39)19-10-11-20(37(40)41)16(2)13-19)15-30-32-27(38)24-23(18-7-5-4-6-8-18)31-35-36(24)26-25(29)33-44-34-26/h4-15H,3H2,1-2H3,(H2,29,33)(H,32,38)/b30-15+ |
| InChIKey | ZSKPHMWRJJWXPC-FJEPWZHXSA-N |
| XLogP | 3.50 |
| TPSA | 215.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.55 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|