C22H19N9O7 — CID 3740998
[4-[[[3-(4-amino-1,2,5-oxadiazol-3-yl)-5-methyltriazole-4-carbonyl]hydrazinylidene]methyl]-2-methoxyphenyl] 2-methyl-3-nitrobenzoate (PubChem CID 3740998) has the molecular formula C22H19N9O7 and a molecular weight of 521.45 g/mol. Its IUPAC name is [4-[[[3-(4-amino-1,2,5-oxadiazol-3-yl)-5-methyltriazole-4-carbonyl]hydrazinylidene]methyl]-2-methoxyphenyl] 2-methyl-3-nitrobenzoate.
| Compound Name | [4-[[[3-(4-amino-1,2,5-oxadiazol-3-yl)-5-methyltriazole-4-carbonyl]hydrazinylidene]methyl]-2-methoxyphenyl] 2-methyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 3740998 |
| Molecular Formula | C22H19N9O7 |
| Molecular Weight | 521.45 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | [4-[[[3-(4-amino-1,2,5-oxadiazol-3-yl)-5-methyltriazole-4-carbonyl]hydrazinylidene]methyl]-2-methoxyphenyl] 2-methyl-3-nitrobenzoate |
| SMILES | COc1cc(C=NNC(=O)c2c(C)nnn2-c2nonc2N)ccc1OC(=O)c1cccc([N+](=O)[O-])c1C |
| InChI | InChI=1S/C22H19N9O7/c1-11-14(5-4-6-15(11)31(34)35)22(33)37-16-8-7-13(9-17(16)36-3)10-24-26-21(32)18-12(2)25-29-30(18)20-19(23)27-38-28-20/h4-10H,1-3H3,(H2,23,27)(H,26,32) |
| InChIKey | UWLXWDJDBHKFJH-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 215.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.45 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|