C27H21N3O7 — CID 6027427
[4-[(Z)-[(3-hydroxynaphthalene-2-carbonyl)hydrazinylidene]methyl]-2-methoxyphenyl] 2-methyl-3-nitrobenzoate (PubChem CID 6027427) has the molecular formula C27H21N3O7 and a molecular weight of 499.48 g/mol. Its IUPAC name is [4-[(Z)-[(3-hydroxynaphthalene-2-carbonyl)hydrazinylidene]methyl]-2-methoxyphenyl] 2-methyl-3-nitrobenzoate.
| Compound Name | [4-[(Z)-[(3-hydroxynaphthalene-2-carbonyl)hydrazinylidene]methyl]-2-methoxyphenyl] 2-methyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 6027427 |
| Molecular Formula | C27H21N3O7 |
| Molecular Weight | 499.48 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | [4-[(Z)-[(3-hydroxynaphthalene-2-carbonyl)hydrazinylidene]methyl]-2-methoxyphenyl] 2-methyl-3-nitrobenzoate |
| SMILES | COc1cc(/C=N\NC(=O)c2cc3ccccc3cc2O)ccc1OC(=O)c1cccc([N+](=O)[O-])c1C |
| InChI | InChI=1S/C27H21N3O7/c1-16-20(8-5-9-22(16)30(34)35)27(33)37-24-11-10-17(12-25(24)36-2)15-28-29-26(32)21-13-18-6-3-4-7-19(18)14-23(21)31/h3-15,31H,1-2H3,(H,29,32)/b28-15- |
| InChIKey | SUBMLFWGFYXARE-MBTHVWNTSA-N |
| XLogP | 4.75 |
| TPSA | 140.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.48 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_acyl_naphthol(22)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|