C19H17N7O6 — CID 131666004
[4-[(E)-[[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]hydrazinylidene]methyl]-2-methoxyphenyl] 2-methyl-3-nitrobenzoate (PubChem CID 131666004) has the molecular formula C19H17N7O6 and a molecular weight of 439.39 g/mol. Its IUPAC name is [4-[(E)-[[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]hydrazinylidene]methyl]-2-methoxyphenyl] 2-methyl-3-nitrobenzoate.
| Compound Name | [4-[(E)-[[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]hydrazinylidene]methyl]-2-methoxyphenyl] 2-methyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 131666004 |
| Molecular Formula | C19H17N7O6 |
| Molecular Weight | 439.39 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | [4-[(E)-[[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]hydrazinylidene]methyl]-2-methoxyphenyl] 2-methyl-3-nitrobenzoate |
| SMILES | COc1cc(/C=N/N=C(N)c2nonc2N)ccc1OC(=O)c1cccc([N+](=O)[O-])c1C |
| InChI | InChI=1S/C19H17N7O6/c1-10-12(4-3-5-13(10)26(28)29)19(27)31-14-7-6-11(8-15(14)30-2)9-22-23-17(20)16-18(21)25-32-24-16/h3-9H,1-2H3,(H2,20,23)(H2,21,25)/b22-9+ |
| InChIKey | DBQFYJQFDQDWEU-LSFURLLWSA-N |
| XLogP | 1.84 |
| TPSA | 194.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.39 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|