C14H16N6O5 — CID 6851471
[4-[(Z)-[[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]hydrazinylidene]methyl]-2,6-dimethoxyphenyl] acetate (PubChem CID 6851471) has the molecular formula C14H16N6O5 and a molecular weight of 348.32 g/mol. Its IUPAC name is [4-[(Z)-[[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]hydrazinylidene]methyl]-2,6-dimethoxyphenyl] acetate.
| Compound Name | [4-[(Z)-[[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]hydrazinylidene]methyl]-2,6-dimethoxyphenyl] acetate |
|---|---|
| PubChem CID | 6851471 |
| Molecular Formula | C14H16N6O5 |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | [4-[(Z)-[[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]hydrazinylidene]methyl]-2,6-dimethoxyphenyl] acetate |
| SMILES | COc1cc(/C=N\N=C(N)c2nonc2N)cc(OC)c1OC(C)=O |
| InChI | InChI=1S/C14H16N6O5/c1-7(21)24-12-9(22-2)4-8(5-10(12)23-3)6-17-18-13(15)11-14(16)20-25-19-11/h4-6H,1-3H3,(H2,15,18)(H2,16,20)/b17-6- |
| InChIKey | ZNDNWIWXFOOLQM-FMQZQXMHSA-N |
| XLogP | 0.33 |
| TPSA | 160.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|