C12H14N6O — CID 43834602
4-amino-N'-[(4-ethylphenyl)methylideneamino]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 43834602) has the molecular formula C12H14N6O and a molecular weight of 258.29 g/mol. Its IUPAC name is 4-amino-N'-[(4-ethylphenyl)methylideneamino]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | 4-amino-N'-[(4-ethylphenyl)methylideneamino]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 43834602 |
| Molecular Formula | C12H14N6O |
| Molecular Weight | 258.29 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 4-amino-N'-[(4-ethylphenyl)methylideneamino]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | CCc1ccc(C=N/N=C(\N)c2nonc2N)cc1 |
| InChI | InChI=1S/C12H14N6O/c1-2-8-3-5-9(6-4-8)7-15-16-11(13)10-12(14)18-19-17-10/h3-7H,2H2,1H3,(H2,13,16)(H2,14,18) |
| InChIKey | UXDOSDVXEJNBIA-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 115.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.29 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|