C10H15ClN4 — CID 87880634
2-[(E)-(4-ethylphenyl)methylideneamino]guanidine;hydrochloride (PubChem CID 87880634) has the molecular formula C10H15ClN4 and a molecular weight of 226.71 g/mol. Its IUPAC name is 2-[(E)-(4-ethylphenyl)methylideneamino]guanidine;hydrochloride.
| Compound Name | 2-[(E)-(4-ethylphenyl)methylideneamino]guanidine;hydrochloride |
|---|---|
| PubChem CID | 87880634 |
| Molecular Formula | C10H15ClN4 |
| Molecular Weight | 226.71 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 2-[(E)-(4-ethylphenyl)methylideneamino]guanidine;hydrochloride |
| SMILES | CCc1ccc(/C=N/N=C(N)N)cc1.Cl |
| InChI | InChI=1S/C10H14N4.ClH/c1-2-8-3-5-9(6-4-8)7-13-14-10(11)12;/h3-7H,2H2,1H3,(H4,11,12,14);1H/b13-7+; |
| InChIKey | VYKAYKPGYCMYNX-FTPOTTDRSA-N |
| XLogP | 1.28 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.71 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|