C16H26N4 — CID 166950257
2-[(E)-(4-octylphenyl)methylideneamino]guanidine (PubChem CID 166950257) has the molecular formula C16H26N4 and a molecular weight of 274.41 g/mol. Its IUPAC name is 2-[(E)-(4-octylphenyl)methylideneamino]guanidine.
| Compound Name | 2-[(E)-(4-octylphenyl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 166950257 |
| Molecular Formula | C16H26N4 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.22 |
| IUPAC Name | 2-[(E)-(4-octylphenyl)methylideneamino]guanidine |
| SMILES | CCCCCCCCc1ccc(/C=N/N=C(N)N)cc1 |
| InChI | InChI=1S/C16H26N4/c1-2-3-4-5-6-7-8-14-9-11-15(12-10-14)13-19-20-16(17)18/h9-13H,2-8H2,1H3,(H4,17,18,20)/b19-13+ |
| InChIKey | GAPOUGBCJMHIAN-CPNJWEJPSA-N |
| XLogP | 3.20 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|