C10H14N4O2S — CID 168591897
2-[[4-(methylsulfonylmethyl)phenyl]methylideneamino]guanidine (PubChem CID 168591897) has the molecular formula C10H14N4O2S and a molecular weight of 254.32 g/mol. Its IUPAC name is 2-[[4-(methylsulfonylmethyl)phenyl]methylideneamino]guanidine.
| Compound Name | 2-[[4-(methylsulfonylmethyl)phenyl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 168591897 |
| Molecular Formula | C10H14N4O2S |
| Molecular Weight | 254.32 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 2-[[4-(methylsulfonylmethyl)phenyl]methylideneamino]guanidine |
| SMILES | CS(=O)(=O)Cc1ccc(C=NN=C(N)N)cc1 |
| InChI | InChI=1S/C10H14N4O2S/c1-17(15,16)7-9-4-2-8(3-5-9)6-13-14-10(11)12/h2-6H,7H2,1H3,(H4,11,12,14) |
| InChIKey | VUVGAMJQHLNFHX-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 110.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.32 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|