C10H14N6O — CID 89220020
1-[4-[(E)-(diaminomethylidenehydrazinylidene)methyl]phenyl]-3-methylurea (PubChem CID 89220020) has the molecular formula C10H14N6O and a molecular weight of 234.26 g/mol. Its IUPAC name is 1-[4-[(E)-(diaminomethylidenehydrazinylidene)methyl]phenyl]-3-methylurea.
| Compound Name | 1-[4-[(E)-(diaminomethylidenehydrazinylidene)methyl]phenyl]-3-methylurea |
|---|---|
| PubChem CID | 89220020 |
| Molecular Formula | C10H14N6O |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 1-[4-[(E)-(diaminomethylidenehydrazinylidene)methyl]phenyl]-3-methylurea |
| SMILES | CNC(=O)Nc1ccc(/C=N/N=C(N)N)cc1 |
| InChI | InChI=1S/C10H14N6O/c1-13-10(17)15-8-4-2-7(3-5-8)6-14-16-9(11)12/h2-6H,1H3,(H4,11,12,16)(H2,13,15,17)/b14-6+ |
| InChIKey | BAVRRFRVNGNFKV-MKMNVTDBSA-N |
| XLogP | 0.05 |
| TPSA | 117.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|