C9H10ClN5O — CID 44531277
N-(4-chlorophenyl)-2-(diaminomethylidenehydrazinylidene)acetamide (PubChem CID 44531277) has the molecular formula C9H10ClN5O and a molecular weight of 239.67 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-(diaminomethylidenehydrazinylidene)acetamide.
| Compound Name | N-(4-chlorophenyl)-2-(diaminomethylidenehydrazinylidene)acetamide |
|---|---|
| PubChem CID | 44531277 |
| Molecular Formula | C9H10ClN5O |
| Molecular Weight | 239.67 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | N-(4-chlorophenyl)-2-(diaminomethylidenehydrazinylidene)acetamide |
| SMILES | NC(N)=NN=CC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H10ClN5O/c10-6-1-3-7(4-2-6)14-8(16)5-13-15-9(11)12/h1-5H,(H,14,16)(H4,11,12,15) |
| InChIKey | BIHJZKVZHYGANN-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 105.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.67 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|