C11H15N5O — CID 45481384
(2E)-2-(diaminomethylidenehydrazinylidene)-N-(4-ethylphenyl)acetamide (PubChem CID 45481384) has the molecular formula C11H15N5O and a molecular weight of 233.28 g/mol. Its IUPAC name is (2E)-2-(diaminomethylidenehydrazinylidene)-N-(4-ethylphenyl)acetamide.
| Compound Name | (2E)-2-(diaminomethylidenehydrazinylidene)-N-(4-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 45481384 |
| Molecular Formula | C11H15N5O |
| Molecular Weight | 233.28 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | (2E)-2-(diaminomethylidenehydrazinylidene)-N-(4-ethylphenyl)acetamide |
| SMILES | CCc1ccc(NC(=O)/C=N/N=C(N)N)cc1 |
| InChI | InChI=1S/C11H15N5O/c1-2-8-3-5-9(6-4-8)15-10(17)7-14-16-11(12)13/h3-7H,2H2,1H3,(H,15,17)(H4,12,13,16)/b14-7+ |
| InChIKey | CTHGMQQHUYPBLC-VGOFMYFVSA-N |
| XLogP | 0.45 |
| TPSA | 105.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.28 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|