C12H17N3 — CID 178169838
(E)-2-N-(4-ethylphenyl)-3-methyliminoprop-1-ene-1,2-diamine (PubChem CID 178169838) has the molecular formula C12H17N3 and a molecular weight of 203.29 g/mol. Its IUPAC name is (E)-2-N-(4-ethylphenyl)-3-methyliminoprop-1-ene-1,2-diamine.
| Compound Name | (E)-2-N-(4-ethylphenyl)-3-methyliminoprop-1-ene-1,2-diamine |
|---|---|
| PubChem CID | 178169838 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | (E)-2-N-(4-ethylphenyl)-3-methyliminoprop-1-ene-1,2-diamine |
| SMILES | CCc1ccc(NC(/C=N/C)=C/N)cc1 |
| InChI | InChI=1S/C12H17N3/c1-3-10-4-6-11(7-5-10)15-12(8-13)9-14-2/h4-9,15H,3,13H2,1-2H3/b12-8+,14-9+ |
| InChIKey | MAFXYLBFQDYODG-MXOVAJDFSA-N |
| XLogP | 2.16 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|