C20H22N8O2 — CID 131882450
N-[4-[[(Z)-[(2Z)-2-[(4-acetamidophenyl)methylidenehydrazinylidene]-1,2-diaminoethylidene]hydrazinylidene]methyl]phenyl]acetamide (PubChem CID 131882450) has the molecular formula C20H22N8O2 and a molecular weight of 406.45 g/mol. Its IUPAC name is N-[4-[[(Z)-[(2Z)-2-[(4-acetamidophenyl)methylidenehydrazinylidene]-1,2-diaminoethylidene]hydrazinylidene]methyl]phenyl]acetamide.
| Compound Name | N-[4-[[(Z)-[(2Z)-2-[(4-acetamidophenyl)methylidenehydrazinylidene]-1,2-diaminoethylidene]hydrazinylidene]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 131882450 |
| Molecular Formula | C20H22N8O2 |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | N-[4-[[(Z)-[(2Z)-2-[(4-acetamidophenyl)methylidenehydrazinylidene]-1,2-diaminoethylidene]hydrazinylidene]methyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C=N/N=C(N)/C(N)=N/N=Cc2ccc(NC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C20H22N8O2/c1-13(29)25-17-7-3-15(4-8-17)11-23-27-19(21)20(22)28-24-12-16-5-9-18(10-6-16)26-14(2)30/h3-12H,1-2H3,(H2,21,27)(H2,22,28)(H,25,29)(H,26,30) |
| InChIKey | DDUKWFXIXYOYBY-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 159.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|