C18H20N6 — CID 171376890
1-N',2-N'-bis[(Z)-(4-methylphenyl)methylideneamino]ethanediimidamide (PubChem CID 171376890) has the molecular formula C18H20N6 and a molecular weight of 320.40 g/mol. Its IUPAC name is 1-N',2-N'-bis[(Z)-(4-methylphenyl)methylideneamino]ethanediimidamide.
| Compound Name | 1-N',2-N'-bis[(Z)-(4-methylphenyl)methylideneamino]ethanediimidamide |
|---|---|
| PubChem CID | 171376890 |
| Molecular Formula | C18H20N6 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 1-N',2-N'-bis[(Z)-(4-methylphenyl)methylideneamino]ethanediimidamide |
| SMILES | Cc1ccc(/C=N\N=C(N)\C(N)=N\N=C/c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C18H20N6/c1-13-3-7-15(8-4-13)11-21-23-17(19)18(20)24-22-12-16-9-5-14(2)6-10-16/h3-12H,1-2H3,(H2,19,23)(H2,20,24)/b21-11-,22-12- |
| InChIKey | CHDRVRUKPRQMLW-IINORCHSSA-N |
| XLogP | 2.39 |
| TPSA | 101.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|