C22H21ClN6 — CID 137394709
2-[(E)-[4-[4-[(E)-[(2-chloro-5-methylphenyl)hydrazinylidene]methyl]phenyl]phenyl]methylideneamino]guanidine (PubChem CID 137394709) has the molecular formula C22H21ClN6 and a molecular weight of 404.91 g/mol. Its IUPAC name is 2-[(E)-[4-[4-[(E)-[(2-chloro-5-methylphenyl)hydrazinylidene]methyl]phenyl]phenyl]methylideneamino]guanidine.
| Compound Name | 2-[(E)-[4-[4-[(E)-[(2-chloro-5-methylphenyl)hydrazinylidene]methyl]phenyl]phenyl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 137394709 |
| Molecular Formula | C22H21ClN6 |
| Molecular Weight | 404.91 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 2-[(E)-[4-[4-[(E)-[(2-chloro-5-methylphenyl)hydrazinylidene]methyl]phenyl]phenyl]methylideneamino]guanidine |
| SMILES | Cc1ccc(Cl)c(N/N=C/c2ccc(-c3ccc(/C=N/N=C(N)N)cc3)cc2)c1 |
| InChI | InChI=1S/C22H21ClN6/c1-15-2-11-20(23)21(12-15)28-26-13-16-3-7-18(8-4-16)19-9-5-17(6-10-19)14-27-29-22(24)25/h2-14,28H,1H3,(H4,24,25,29)/b26-13+,27-14+ |
| InChIKey | DNFMFQOBDXZOQW-BMNRKXRESA-N |
| XLogP | 4.37 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.91 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|